C24H36N6O2 — CID 86813158
N-[1-(1H-benzimidazol-2-ylmethyl)piperidin-4-yl]-4-(cyclohexylcarbamoylamino)butanamide (PubChem CID 86813158) has the molecular formula C24H36N6O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-ylmethyl)piperidin-4-yl]-4-(cyclohexylcarbamoylamino)butanamide.
| Compound Name | N-[1-(1H-benzimidazol-2-ylmethyl)piperidin-4-yl]-4-(cyclohexylcarbamoylamino)butanamide |
|---|---|
| PubChem CID | 86813158 |
| Molecular Formula | C24H36N6O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-ylmethyl)piperidin-4-yl]-4-(cyclohexylcarbamoylamino)butanamide |
| SMILES | O=C(CCCNC(=O)NC1CCCCC1)NC1CCN(Cc2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C24H36N6O2/c31-23(11-6-14-25-24(32)27-18-7-2-1-3-8-18)26-19-12-15-30(16-13-19)17-22-28-20-9-4-5-10-21(20)29-22/h4-5,9-10,18-19H,1-3,6-8,11-17H2,(H,26,31)(H,28,29)(H2,25,27,32) |
| InChIKey | UWBGFNIVUWMCMK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|