C20H22ClN5O3 — CID 86813204
1-[3-chloro-2-(2-ethoxyethoxy)phenyl]-3-[1-(pyridin-2-ylmethyl)pyrazol-3-yl]urea (PubChem CID 86813204) has the molecular formula C20H22ClN5O3 and a molecular weight of 415.88 g/mol. Its IUPAC name is 1-[3-chloro-2-(2-ethoxyethoxy)phenyl]-3-[1-(pyridin-2-ylmethyl)pyrazol-3-yl]urea.
| Compound Name | 1-[3-chloro-2-(2-ethoxyethoxy)phenyl]-3-[1-(pyridin-2-ylmethyl)pyrazol-3-yl]urea |
|---|---|
| PubChem CID | 86813204 |
| Molecular Formula | C20H22ClN5O3 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 1-[3-chloro-2-(2-ethoxyethoxy)phenyl]-3-[1-(pyridin-2-ylmethyl)pyrazol-3-yl]urea |
| SMILES | CCOCCOc1c(Cl)cccc1NC(=O)Nc1ccn(Cc2ccccn2)n1 |
| InChI | InChI=1S/C20H22ClN5O3/c1-2-28-12-13-29-19-16(21)7-5-8-17(19)23-20(27)24-18-9-11-26(25-18)14-15-6-3-4-10-22-15/h3-11H,2,12-14H2,1H3,(H2,23,24,25,27) |
| InChIKey | ORTMNYLCEMMFLC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|