C13H15N3O3S — CID 86818674
methyl 2-(1-methylpyrazol-3-yl)-2-[(2-thiophen-3-ylacetyl)amino]acetate (PubChem CID 86818674) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is methyl 2-(1-methylpyrazol-3-yl)-2-[(2-thiophen-3-ylacetyl)amino]acetate.
| Compound Name | methyl 2-(1-methylpyrazol-3-yl)-2-[(2-thiophen-3-ylacetyl)amino]acetate |
|---|---|
| PubChem CID | 86818674 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | methyl 2-(1-methylpyrazol-3-yl)-2-[(2-thiophen-3-ylacetyl)amino]acetate |
| SMILES | COC(=O)C(NC(=O)Cc1ccsc1)c1ccn(C)n1 |
| InChI | InChI=1S/C13H15N3O3S/c1-16-5-3-10(15-16)12(13(18)19-2)14-11(17)7-9-4-6-20-8-9/h3-6,8,12H,7H2,1-2H3,(H,14,17) |
| InChIKey | ZRXIPFFEIPUFOA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |