C21H32N4O4S — CID 86819529
tert-butyl 4-[3-cyanopropylsulfonyl(pyridin-2-ylmethyl)amino]azepane-1-carboxylate (PubChem CID 86819529) has the molecular formula C21H32N4O4S and a molecular weight of 436.58 g/mol. Its IUPAC name is tert-butyl 4-[3-cyanopropylsulfonyl(pyridin-2-ylmethyl)amino]azepane-1-carboxylate.
| Compound Name | tert-butyl 4-[3-cyanopropylsulfonyl(pyridin-2-ylmethyl)amino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 86819529 |
| Molecular Formula | C21H32N4O4S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | tert-butyl 4-[3-cyanopropylsulfonyl(pyridin-2-ylmethyl)amino]azepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(N(Cc2ccccn2)S(=O)(=O)CCCC#N)CC1 |
| InChI | InChI=1S/C21H32N4O4S/c1-21(2,3)29-20(26)24-14-8-10-19(11-15-24)25(17-18-9-4-6-13-23-18)30(27,28)16-7-5-12-22/h4,6,9,13,19H,5,7-8,10-11,14-17H2,1-3H3 |
| InChIKey | OLWLDDBVTJSLHT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 103.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|