C17H20FNO3S — CID 86819915
1-(4-fluoro-2-methylphenyl)-N-(2-methoxy-2-phenylethyl)methanesulfonamide (PubChem CID 86819915) has the molecular formula C17H20FNO3S and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)-N-(2-methoxy-2-phenylethyl)methanesulfonamide.
| Compound Name | 1-(4-fluoro-2-methylphenyl)-N-(2-methoxy-2-phenylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 86819915 |
| Molecular Formula | C17H20FNO3S |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)-N-(2-methoxy-2-phenylethyl)methanesulfonamide |
| SMILES | COC(CNS(=O)(=O)Cc1ccc(F)cc1C)c1ccccc1 |
| InChI | InChI=1S/C17H20FNO3S/c1-13-10-16(18)9-8-15(13)12-23(20,21)19-11-17(22-2)14-6-4-3-5-7-14/h3-10,17,19H,11-12H2,1-2H3 |
| InChIKey | GUFYRQOHHFMDAD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |