C7H8BrN3O2S — CID 86835866
1-[(5-bromothiophene-3-carbonyl)amino]-3-methylurea (PubChem CID 86835866) has the molecular formula C7H8BrN3O2S and a molecular weight of 278.13 g/mol. Its IUPAC name is 1-[(5-bromothiophene-3-carbonyl)amino]-3-methylurea.
| Compound Name | 1-[(5-bromothiophene-3-carbonyl)amino]-3-methylurea |
|---|---|
| PubChem CID | 86835866 |
| Molecular Formula | C7H8BrN3O2S |
| Molecular Weight | 278.13 g/mol |
| Exact Mass | 276.95 |
| IUPAC Name | 1-[(5-bromothiophene-3-carbonyl)amino]-3-methylurea |
| SMILES | CNC(=O)NNC(=O)c1csc(Br)c1 |
| InChI | InChI=1S/C7H8BrN3O2S/c1-9-7(13)11-10-6(12)4-2-5(8)14-3-4/h2-3H,1H3,(H,10,12)(H2,9,11,13) |
| InChIKey | AYESOXVGTJMZOF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.13 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|