C17H16FN5O2S — CID 86854839
N-cyclopropyl-N-[(3-fluorophenyl)methyl]-3-(tetrazol-1-yl)benzenesulfonamide (PubChem CID 86854839) has the molecular formula C17H16FN5O2S and a molecular weight of 373.41 g/mol. Its IUPAC name is N-cyclopropyl-N-[(3-fluorophenyl)methyl]-3-(tetrazol-1-yl)benzenesulfonamide.
| Compound Name | N-cyclopropyl-N-[(3-fluorophenyl)methyl]-3-(tetrazol-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 86854839 |
| Molecular Formula | C17H16FN5O2S |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-cyclopropyl-N-[(3-fluorophenyl)methyl]-3-(tetrazol-1-yl)benzenesulfonamide |
| SMILES | O=S(=O)(c1cccc(-n2cnnn2)c1)N(Cc1cccc(F)c1)C1CC1 |
| InChI | InChI=1S/C17H16FN5O2S/c18-14-4-1-3-13(9-14)11-23(15-7-8-15)26(24,25)17-6-2-5-16(10-17)22-12-19-20-21-22/h1-6,9-10,12,15H,7-8,11H2 |
| InChIKey | RIDWHAZZZTVSQE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |