C18H20FNO4S2 — CID 87032983
N-cyclopropyl-4-ethylsulfonyl-N-[(3-fluorophenyl)methyl]benzenesulfonamide (PubChem CID 87032983) has the molecular formula C18H20FNO4S2 and a molecular weight of 397.49 g/mol. Its IUPAC name is N-cyclopropyl-4-ethylsulfonyl-N-[(3-fluorophenyl)methyl]benzenesulfonamide.
| Compound Name | N-cyclopropyl-4-ethylsulfonyl-N-[(3-fluorophenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 87032983 |
| Molecular Formula | C18H20FNO4S2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | N-cyclopropyl-4-ethylsulfonyl-N-[(3-fluorophenyl)methyl]benzenesulfonamide |
| SMILES | CCS(=O)(=O)c1ccc(S(=O)(=O)N(Cc2cccc(F)c2)C2CC2)cc1 |
| InChI | InChI=1S/C18H20FNO4S2/c1-2-25(21,22)17-8-10-18(11-9-17)26(23,24)20(16-6-7-16)13-14-4-3-5-15(19)12-14/h3-5,8-12,16H,2,6-7,13H2,1H3 |
| InChIKey | VUMJYSGIDAOZFR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |