C23H22N2O3S2 — CID 86878265
N-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzamide (PubChem CID 86878265) has the molecular formula C23H22N2O3S2 and a molecular weight of 438.57 g/mol. Its IUPAC name is N-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzamide.
| Compound Name | N-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 86878265 |
| Molecular Formula | C23H22N2O3S2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | N-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzamide |
| SMILES | C#CCOc1cc(CNC(=O)c2ccc(SCc3csc(C)n3)cc2)ccc1OC |
| InChI | InChI=1S/C23H22N2O3S2/c1-4-11-28-22-12-17(5-10-21(22)27-3)13-24-23(26)18-6-8-20(9-7-18)30-15-19-14-29-16(2)25-19/h1,5-10,12,14H,11,13,15H2,2-3H3,(H,24,26) |
| InChIKey | XTBKLHKVFGNZBF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|