C20H29N3OS — CID 86880064
3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-methyl-1-(4-phenylbutyl)urea (PubChem CID 86880064) has the molecular formula C20H29N3OS and a molecular weight of 359.54 g/mol. Its IUPAC name is 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-methyl-1-(4-phenylbutyl)urea.
| Compound Name | 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-methyl-1-(4-phenylbutyl)urea |
|---|---|
| PubChem CID | 86880064 |
| Molecular Formula | C20H29N3OS |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-methyl-1-(4-phenylbutyl)urea |
| SMILES | CN(CCCCc1ccccc1)C(=O)NCc1csc(C(C)(C)C)n1 |
| InChI | InChI=1S/C20H29N3OS/c1-20(2,3)18-22-17(15-25-18)14-21-19(24)23(4)13-9-8-12-16-10-6-5-7-11-16/h5-7,10-11,15H,8-9,12-14H2,1-4H3,(H,21,24) |
| InChIKey | UDIGXNTWXQIVGX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|