C20H20N4O2 — CID 86888245
2-[2-[N-(furan-2-ylmethyl)-4-methylanilino]ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 86888245) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-[2-[N-(furan-2-ylmethyl)-4-methylanilino]ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[2-[N-(furan-2-ylmethyl)-4-methylanilino]ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 86888245 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-[2-[N-(furan-2-ylmethyl)-4-methylanilino]ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | Cc1ccc(N(CCn2nc3ccccn3c2=O)Cc2ccco2)cc1 |
| InChI | InChI=1S/C20H20N4O2/c1-16-7-9-17(10-8-16)22(15-18-5-4-14-26-18)12-13-24-20(25)23-11-3-2-6-19(23)21-24/h2-11,14H,12-13,15H2,1H3 |
| InChIKey | IYIOVYOCOVAVOE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|