C18H24F2N2O4S — CID 86888685
N'-(3,5-difluoro-4-methylsulfonylphenyl)-N-(2-propan-2-ylcyclohexyl)oxamide (PubChem CID 86888685) has the molecular formula C18H24F2N2O4S and a molecular weight of 402.46 g/mol. Its IUPAC name is N'-(3,5-difluoro-4-methylsulfonylphenyl)-N-(2-propan-2-ylcyclohexyl)oxamide.
| Compound Name | N'-(3,5-difluoro-4-methylsulfonylphenyl)-N-(2-propan-2-ylcyclohexyl)oxamide |
|---|---|
| PubChem CID | 86888685 |
| Molecular Formula | C18H24F2N2O4S |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N'-(3,5-difluoro-4-methylsulfonylphenyl)-N-(2-propan-2-ylcyclohexyl)oxamide |
| SMILES | CC(C)C1CCCCC1NC(=O)C(=O)Nc1cc(F)c(S(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C18H24F2N2O4S/c1-10(2)12-6-4-5-7-15(12)22-18(24)17(23)21-11-8-13(19)16(14(20)9-11)27(3,25)26/h8-10,12,15H,4-7H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | UNUAQAQXHRVFFW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|