C22H22FN3O2S — CID 86888842
N-[1-[3-(4-cyanophenyl)sulfanylpropanoyl]piperidin-4-yl]-2-fluorobenzamide (PubChem CID 86888842) has the molecular formula C22H22FN3O2S and a molecular weight of 411.50 g/mol. Its IUPAC name is N-[1-[3-(4-cyanophenyl)sulfanylpropanoyl]piperidin-4-yl]-2-fluorobenzamide.
| Compound Name | N-[1-[3-(4-cyanophenyl)sulfanylpropanoyl]piperidin-4-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 86888842 |
| Molecular Formula | C22H22FN3O2S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-[1-[3-(4-cyanophenyl)sulfanylpropanoyl]piperidin-4-yl]-2-fluorobenzamide |
| SMILES | N#Cc1ccc(SCCC(=O)N2CCC(NC(=O)c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C22H22FN3O2S/c23-20-4-2-1-3-19(20)22(28)25-17-9-12-26(13-10-17)21(27)11-14-29-18-7-5-16(15-24)6-8-18/h1-8,17H,9-14H2,(H,25,28) |
| InChIKey | OHZRSWVYVHFSMU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |