C19H24FN3O3S — CID 86889898
N-cyclooctyl-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfonylacetamide (PubChem CID 86889898) has the molecular formula C19H24FN3O3S and a molecular weight of 393.48 g/mol. Its IUPAC name is N-cyclooctyl-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfonylacetamide.
| Compound Name | N-cyclooctyl-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfonylacetamide |
|---|---|
| PubChem CID | 86889898 |
| Molecular Formula | C19H24FN3O3S |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-cyclooctyl-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfonylacetamide |
| SMILES | O=C(CS(=O)(=O)c1nccn1-c1cccc(F)c1)NC1CCCCCCC1 |
| InChI | InChI=1S/C19H24FN3O3S/c20-15-7-6-10-17(13-15)23-12-11-21-19(23)27(25,26)14-18(24)22-16-8-4-2-1-3-5-9-16/h6-7,10-13,16H,1-5,8-9,14H2,(H,22,24) |
| InChIKey | GXBQRQUERCMPLI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |