C23H27N5O3 — CID 86892491
ethyl 4-[[2-[4-(1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]acetyl]amino]benzoate (PubChem CID 86892491) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is ethyl 4-[[2-[4-(1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[4-(1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 86892491 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | ethyl 4-[[2-[4-(1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN2CCCN(c3nc4ccccc4[nH]3)CC2)cc1 |
| InChI | InChI=1S/C23H27N5O3/c1-2-31-22(30)17-8-10-18(11-9-17)24-21(29)16-27-12-5-13-28(15-14-27)23-25-19-6-3-4-7-20(19)26-23/h3-4,6-11H,2,5,12-16H2,1H3,(H,24,29)(H,25,26) |
| InChIKey | DUKHCGQZUBSXFD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |