C23H29N3O2S — CID 86899655
1-[2-methyl-5-(thiomorpholine-4-carbonyl)phenyl]-3-(2-phenylbutan-2-yl)urea (PubChem CID 86899655) has the molecular formula C23H29N3O2S and a molecular weight of 411.57 g/mol. Its IUPAC name is 1-[2-methyl-5-(thiomorpholine-4-carbonyl)phenyl]-3-(2-phenylbutan-2-yl)urea.
| Compound Name | 1-[2-methyl-5-(thiomorpholine-4-carbonyl)phenyl]-3-(2-phenylbutan-2-yl)urea |
|---|---|
| PubChem CID | 86899655 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 1-[2-methyl-5-(thiomorpholine-4-carbonyl)phenyl]-3-(2-phenylbutan-2-yl)urea |
| SMILES | CCC(C)(NC(=O)Nc1cc(C(=O)N2CCSCC2)ccc1C)c1ccccc1 |
| InChI | InChI=1S/C23H29N3O2S/c1-4-23(3,19-8-6-5-7-9-19)25-22(28)24-20-16-18(11-10-17(20)2)21(27)26-12-14-29-15-13-26/h5-11,16H,4,12-15H2,1-3H3,(H2,24,25,28) |
| InChIKey | RJSJNBIPHSDFNN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |