C16H18ClN3O2 — CID 86900180
3-(4-chlorophenyl)-N-[2-(cyclopropylmethoxy)ethyl]-1H-pyrazole-5-carboxamide (PubChem CID 86900180) has the molecular formula C16H18ClN3O2 and a molecular weight of 319.79 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[2-(cyclopropylmethoxy)ethyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-[2-(cyclopropylmethoxy)ethyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 86900180 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[2-(cyclopropylmethoxy)ethyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCCOCC1CC1)c1cc(-c2ccc(Cl)cc2)n[nH]1 |
| InChI | InChI=1S/C16H18ClN3O2/c17-13-5-3-12(4-6-13)14-9-15(20-19-14)16(21)18-7-8-22-10-11-1-2-11/h3-6,9,11H,1-2,7-8,10H2,(H,18,21)(H,19,20) |
| InChIKey | CHLFNMXYYFXFAK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|