C15H24N4O3S — CID 86915626
ethyl 4-[[2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetyl]amino]butanoate (PubChem CID 86915626) has the molecular formula C15H24N4O3S and a molecular weight of 340.45 g/mol. Its IUPAC name is ethyl 4-[[2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 86915626 |
| Molecular Formula | C15H24N4O3S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | ethyl 4-[[2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)CN1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C15H24N4O3S/c1-2-22-14(21)4-3-5-16-13(20)12-18-7-9-19(10-8-18)15-17-6-11-23-15/h6,11H,2-5,7-10,12H2,1H3,(H,16,20) |
| InChIKey | OTBIUMJTGRTOMQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|