About N-[1-(2,4-difluorophenyl)ethyl]-1-methylsulfonylpiperidine-2-carboxamide
N-[1-(2,4-difluorophenyl)ethyl]-1-methylsulfonylpiperidine-2-carboxamide (PubChem CID 86920986) has the molecular formula C15H20F2N2O3S
and a molecular weight of 346.40 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-1-methylsulfonylpiperidine-2-carboxamide.
Molecular Properties
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-1-methylsulfonylpiperidine-2-carboxamide |
| PubChem CID | 86920986 |
| Molecular Formula | C15H20F2N2O3S |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-1-methylsulfonylpiperidine-2-carboxamide |
| SMILES | CC(NC(=O)C1CCCCN1S(C)(=O)=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H20F2N2O3S/c1-10(12-7-6-11(16)9-13(12)17)18-15(20)14-5-3-4-8-19(14)23(2,21)22/h6-7,9-10,14H,3-5,8H2,1-2H3,(H,18,20) |
| InChIKey | XSOPDSVJXKVJHP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(2,4-difluorophenyl)ethyl]-1-methylsulfonylpiperidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,4-difluorophenyl)ethyl]-1-methylsulfonylpiperidine-2-carboxamide?
The IUPAC name of N-[1-(2,4-difluorophenyl)ethyl]-1-methylsulfonylpiperidine-2-carboxamide (CID 86920986) is N-[1-(2,4-difluorophenyl)ethyl]-1-methylsulfonylpiperidine-2-carboxamide.
What is the SMILES notation for N-[1-(2,4-difluorophenyl)ethyl]-1-methylsulfonylpiperidine-2-carboxamide?
The canonical SMILES for N-[1-(2,4-difluorophenyl)ethyl]-1-methylsulfonylpiperidine-2-carboxamide is CC(NC(=O)C1CCCCN1S(C)(=O)=O)c1ccc(F)cc1F.
What is the InChIKey of N-[1-(2,4-difluorophenyl)ethyl]-1-methylsulfonylpiperidine-2-carboxamide?
The InChIKey is XSOPDSVJXKVJHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F2N2O3S/c1-10(12-7-6-11(16)9-13(12)17)18-15(20)14-5-3-4-8-19(14)23(2,21)22/h6-7,9-10,14H,3-5,8H2,1-2H3,(H,18,20).
What are the key properties of N-[1-(2,4-difluorophenyl)ethyl]-1-methylsulfonylpiperidine-2-carboxamide?
N-[1-(2,4-difluorophenyl)ethyl]-1-methylsulfonylpiperidine-2-carboxamide has a molecular weight of 346.40 g/mol, XLogP of 1.96, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,4-difluorophenyl)ethyl]-1-methylsulfonylpiperidine-2-carboxamide is sourced from PubChem (CID 86920986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).