C23H17FN2O2 — CID 86926449
N-[(4-fluorophenyl)-phenylmethyl]-1-oxo-2H-isoquinoline-3-carboxamide (PubChem CID 86926449) has the molecular formula C23H17FN2O2 and a molecular weight of 372.40 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-phenylmethyl]-1-oxo-2H-isoquinoline-3-carboxamide.
| Compound Name | N-[(4-fluorophenyl)-phenylmethyl]-1-oxo-2H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 86926449 |
| Molecular Formula | C23H17FN2O2 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-[(4-fluorophenyl)-phenylmethyl]-1-oxo-2H-isoquinoline-3-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccc(F)cc1)c1cc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C23H17FN2O2/c24-18-12-10-16(11-13-18)21(15-6-2-1-3-7-15)26-23(28)20-14-17-8-4-5-9-19(17)22(27)25-20/h1-14,21H,(H,25,27)(H,26,28) |
| InChIKey | VHDKNJZCMCUPIR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |