C16H22ClN4O2+ — CID 8692666
[2-(3-chloro-4-cyanoanilino)-2-oxoethyl]-[2-(diethylamino)-2-oxoethyl]-methylazanium (PubChem CID 8692666) has the molecular formula C16H22ClN4O2+ and a molecular weight of 337.83 g/mol. Its IUPAC name is [2-(3-chloro-4-cyanoanilino)-2-oxoethyl]-[2-(diethylamino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl]-[2-(diethylamino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8692666 |
| Molecular Formula | C16H22ClN4O2+ |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl]-[2-(diethylamino)-2-oxoethyl]-methylazanium |
| SMILES | CCN(CC)C(=O)C[NH+](C)CC(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C16H21ClN4O2/c1-4-21(5-2)16(23)11-20(3)10-15(22)19-13-7-6-12(9-18)14(17)8-13/h6-8H,4-5,10-11H2,1-3H3,(H,19,22)/p+1 |
| InChIKey | YRESGXQMWZWIMY-UHFFFAOYSA-O |
| XLogP | 0.53 |
| TPSA | 77.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |