C19H28N4O3S — CID 86930090
4-(diethylsulfamoyl)-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]benzamide (PubChem CID 86930090) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 86930090 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCCc2c(C)nn(C)c2C)cc1 |
| InChI | InChI=1S/C19H28N4O3S/c1-6-23(7-2)27(25,26)17-10-8-16(9-11-17)19(24)20-13-12-18-14(3)21-22(5)15(18)4/h8-11H,6-7,12-13H2,1-5H3,(H,20,24) |
| InChIKey | FUPVBRGBGRUBRU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |