C16H21N3O3S2 — CID 110284882
4-(diethylsulfamoyl)-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide (PubChem CID 110284882) has the molecular formula C16H21N3O3S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 110284882 |
| Molecular Formula | C16H21N3O3S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCCc2cscn2)cc1 |
| InChI | InChI=1S/C16H21N3O3S2/c1-3-19(4-2)24(21,22)15-7-5-13(6-8-15)16(20)17-10-9-14-11-23-12-18-14/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,17,20) |
| InChIKey | IRWOUVVXZCRRQE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |