About [2-(cyclohexylamino)-2-oxoethyl] 4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoate
[2-(cyclohexylamino)-2-oxoethyl] 4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoate (PubChem CID 86934624) has the molecular formula C23H25N3O3S
and a molecular weight of 423.54 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] 4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoate.
Molecular Properties
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] 4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoate |
| PubChem CID | 86934624 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] 4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(SCc2cn3ccccc3n2)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C23H25N3O3S/c27-22(25-18-6-2-1-3-7-18)15-29-23(28)17-9-11-20(12-10-17)30-16-19-14-26-13-5-4-8-21(26)24-19/h4-5,8-14,18H,1-3,6-7,15-16H2,(H,25,27) |
| InChIKey | YSRVQXQNSBFEAH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(cyclohexylamino)-2-oxoethyl] 4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(cyclohexylamino)-2-oxoethyl] 4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoate?
The IUPAC name of [2-(cyclohexylamino)-2-oxoethyl] 4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoate (CID 86934624) is [2-(cyclohexylamino)-2-oxoethyl] 4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoate.
What is the SMILES notation for [2-(cyclohexylamino)-2-oxoethyl] 4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoate?
The canonical SMILES for [2-(cyclohexylamino)-2-oxoethyl] 4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoate is O=C(COC(=O)c1ccc(SCc2cn3ccccc3n2)cc1)NC1CCCCC1.
What is the InChIKey of [2-(cyclohexylamino)-2-oxoethyl] 4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoate?
The InChIKey is YSRVQXQNSBFEAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O3S/c27-22(25-18-6-2-1-3-7-18)15-29-23(28)17-9-11-20(12-10-17)30-16-19-14-26-13-5-4-8-21(26)24-19/h4-5,8-14,18H,1-3,6-7,15-16H2,(H,25,27).
What are the key properties of [2-(cyclohexylamino)-2-oxoethyl] 4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoate?
[2-(cyclohexylamino)-2-oxoethyl] 4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoate has a molecular weight of 423.54 g/mol, XLogP of 4.23, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(cyclohexylamino)-2-oxoethyl] 4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoate is sourced from PubChem (CID 86934624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).