C17H18F2N2O3S2 — CID 86936158
(4-anilinopiperidin-1-yl)-[3-(difluoromethylsulfonyl)thiophen-2-yl]methanone (PubChem CID 86936158) has the molecular formula C17H18F2N2O3S2 and a molecular weight of 400.47 g/mol. Its IUPAC name is (4-anilinopiperidin-1-yl)-[3-(difluoromethylsulfonyl)thiophen-2-yl]methanone.
| Compound Name | (4-anilinopiperidin-1-yl)-[3-(difluoromethylsulfonyl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 86936158 |
| Molecular Formula | C17H18F2N2O3S2 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | (4-anilinopiperidin-1-yl)-[3-(difluoromethylsulfonyl)thiophen-2-yl]methanone |
| SMILES | O=C(c1sccc1S(=O)(=O)C(F)F)N1CCC(Nc2ccccc2)CC1 |
| InChI | InChI=1S/C17H18F2N2O3S2/c18-17(19)26(23,24)14-8-11-25-15(14)16(22)21-9-6-13(7-10-21)20-12-4-2-1-3-5-12/h1-5,8,11,13,17,20H,6-7,9-10H2 |
| InChIKey | YEJAGWWYULLVPA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |