C13H15F2NO5S2 — CID 122119730
1-[3-(difluoromethylsulfonyl)thiophene-2-carbonyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122119730) has the molecular formula C13H15F2NO5S2 and a molecular weight of 367.40 g/mol. Its IUPAC name is 1-[3-(difluoromethylsulfonyl)thiophene-2-carbonyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[3-(difluoromethylsulfonyl)thiophene-2-carbonyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122119730 |
| Molecular Formula | C13H15F2NO5S2 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 1-[3-(difluoromethylsulfonyl)thiophene-2-carbonyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(C(=O)c2sccc2S(=O)(=O)C(F)F)C1 |
| InChI | InChI=1S/C13H15F2NO5S2/c1-7-4-8(12(18)19)6-16(5-7)11(17)10-9(2-3-22-10)23(20,21)13(14)15/h2-3,7-8,13H,4-6H2,1H3,(H,18,19) |
| InChIKey | UWRWFCCEYPQDGH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |