C23H28FN3O3S — CID 86936375
5-(diethylsulfamoyl)-N-[2-(7-ethyl-1H-indol-3-yl)ethyl]-2-fluorobenzamide (PubChem CID 86936375) has the molecular formula C23H28FN3O3S and a molecular weight of 445.56 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-N-[2-(7-ethyl-1H-indol-3-yl)ethyl]-2-fluorobenzamide.
| Compound Name | 5-(diethylsulfamoyl)-N-[2-(7-ethyl-1H-indol-3-yl)ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 86936375 |
| Molecular Formula | C23H28FN3O3S |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 5-(diethylsulfamoyl)-N-[2-(7-ethyl-1H-indol-3-yl)ethyl]-2-fluorobenzamide |
| SMILES | CCc1cccc2c(CCNC(=O)c3cc(S(=O)(=O)N(CC)CC)ccc3F)c[nH]c12 |
| InChI | InChI=1S/C23H28FN3O3S/c1-4-16-8-7-9-19-17(15-26-22(16)19)12-13-25-23(28)20-14-18(10-11-21(20)24)31(29,30)27(5-2)6-3/h7-11,14-15,26H,4-6,12-13H2,1-3H3,(H,25,28) |
| InChIKey | CEMMYTZNWZTDMV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |