C24H40N4O2 — CID 86937373
4-(adamantane-1-carbonyl)-N-[(1-ethylpiperidin-2-yl)methyl]piperazine-1-carboxamide (PubChem CID 86937373) has the molecular formula C24H40N4O2 and a molecular weight of 416.61 g/mol. Its IUPAC name is 4-(adamantane-1-carbonyl)-N-[(1-ethylpiperidin-2-yl)methyl]piperazine-1-carboxamide.
| Compound Name | 4-(adamantane-1-carbonyl)-N-[(1-ethylpiperidin-2-yl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 86937373 |
| Molecular Formula | C24H40N4O2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.32 |
| IUPAC Name | 4-(adamantane-1-carbonyl)-N-[(1-ethylpiperidin-2-yl)methyl]piperazine-1-carboxamide |
| SMILES | CCN1CCCCC1CNC(=O)N1CCN(C(=O)C23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C24H40N4O2/c1-2-26-6-4-3-5-21(26)17-25-23(30)28-9-7-27(8-10-28)22(29)24-14-18-11-19(15-24)13-20(12-18)16-24/h18-21H,2-17H2,1H3,(H,25,30) |
| InChIKey | GLLSEROGDAQLIW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |