C22H25ClF3NO2 — CID 86941437
1-[[4-(2-chlorophenyl)oxan-4-yl]methylamino]-2-[3-(trifluoromethyl)phenyl]propan-2-ol (PubChem CID 86941437) has the molecular formula C22H25ClF3NO2 and a molecular weight of 427.89 g/mol. Its IUPAC name is 1-[[4-(2-chlorophenyl)oxan-4-yl]methylamino]-2-[3-(trifluoromethyl)phenyl]propan-2-ol.
| Compound Name | 1-[[4-(2-chlorophenyl)oxan-4-yl]methylamino]-2-[3-(trifluoromethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 86941437 |
| Molecular Formula | C22H25ClF3NO2 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 1-[[4-(2-chlorophenyl)oxan-4-yl]methylamino]-2-[3-(trifluoromethyl)phenyl]propan-2-ol |
| SMILES | CC(O)(CNCC1(c2ccccc2Cl)CCOCC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H25ClF3NO2/c1-20(28,16-5-4-6-17(13-16)22(24,25)26)14-27-15-21(9-11-29-12-10-21)18-7-2-3-8-19(18)23/h2-8,13,27-28H,9-12,14-15H2,1H3 |
| InChIKey | SRGSFUNRYYRIPB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |