About 2-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl-(2-phenylethyl)amino]ethanol
2-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl-(2-phenylethyl)amino]ethanol (PubChem CID 86942949) has the molecular formula C21H22N2O3S
and a molecular weight of 382.49 g/mol. Its IUPAC name is 2-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl-(2-phenylethyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl-(2-phenylethyl)amino]ethanol |
| PubChem CID | 86942949 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl-(2-phenylethyl)amino]ethanol |
| SMILES | OCCN(CCc1ccccc1)Cc1csc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C21H22N2O3S/c24-11-10-23(9-8-16-4-2-1-3-5-16)13-18-14-27-21(22-18)17-6-7-19-20(12-17)26-15-25-19/h1-7,12,14,24H,8-11,13,15H2 |
| InChIKey | LGCPTFYKASLNNC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl-(2-phenylethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl-(2-phenylethyl)amino]ethanol?
The IUPAC name of 2-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl-(2-phenylethyl)amino]ethanol (CID 86942949) is 2-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl-(2-phenylethyl)amino]ethanol.
What is the SMILES notation for 2-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl-(2-phenylethyl)amino]ethanol?
The canonical SMILES for 2-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl-(2-phenylethyl)amino]ethanol is OCCN(CCc1ccccc1)Cc1csc(-c2ccc3c(c2)OCO3)n1.
What is the InChIKey of 2-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl-(2-phenylethyl)amino]ethanol?
The InChIKey is LGCPTFYKASLNNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O3S/c24-11-10-23(9-8-16-4-2-1-3-5-16)13-18-14-27-21(22-18)17-6-7-19-20(12-17)26-15-25-19/h1-7,12,14,24H,8-11,13,15H2.
What are the key properties of 2-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl-(2-phenylethyl)amino]ethanol?
2-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl-(2-phenylethyl)amino]ethanol has a molecular weight of 382.49 g/mol, XLogP of 3.58, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl-(2-phenylethyl)amino]ethanol is sourced from PubChem (CID 86942949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).