C20H23ClN4O2 — CID 86958892
[1-(3-chlorophenyl)cyclobutyl]-[4-(6-methoxypyrazin-2-yl)piperazin-1-yl]methanone (PubChem CID 86958892) has the molecular formula C20H23ClN4O2 and a molecular weight of 386.88 g/mol. Its IUPAC name is [1-(3-chlorophenyl)cyclobutyl]-[4-(6-methoxypyrazin-2-yl)piperazin-1-yl]methanone.
| Compound Name | [1-(3-chlorophenyl)cyclobutyl]-[4-(6-methoxypyrazin-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 86958892 |
| Molecular Formula | C20H23ClN4O2 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | [1-(3-chlorophenyl)cyclobutyl]-[4-(6-methoxypyrazin-2-yl)piperazin-1-yl]methanone |
| SMILES | COc1cncc(N2CCN(C(=O)C3(c4cccc(Cl)c4)CCC3)CC2)n1 |
| InChI | InChI=1S/C20H23ClN4O2/c1-27-18-14-22-13-17(23-18)24-8-10-25(11-9-24)19(26)20(6-3-7-20)15-4-2-5-16(21)12-15/h2,4-5,12-14H,3,6-11H2,1H3 |
| InChIKey | GLBUYQLDBZBRSZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |