C22H33N5O2 — CID 86966875
1-(3-ethyl-2-morpholin-4-ylpentyl)-3-[(3-pyrazol-1-ylphenyl)methyl]urea (PubChem CID 86966875) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-(3-ethyl-2-morpholin-4-ylpentyl)-3-[(3-pyrazol-1-ylphenyl)methyl]urea.
| Compound Name | 1-(3-ethyl-2-morpholin-4-ylpentyl)-3-[(3-pyrazol-1-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 86966875 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | 1-(3-ethyl-2-morpholin-4-ylpentyl)-3-[(3-pyrazol-1-ylphenyl)methyl]urea |
| SMILES | CCC(CC)C(CNC(=O)NCc1cccc(-n2cccn2)c1)N1CCOCC1 |
| InChI | InChI=1S/C22H33N5O2/c1-3-19(4-2)21(26-11-13-29-14-12-26)17-24-22(28)23-16-18-7-5-8-20(15-18)27-10-6-9-25-27/h5-10,15,19,21H,3-4,11-14,16-17H2,1-2H3,(H2,23,24,28) |
| InChIKey | HQRZCTSHEUWBFM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |