C21H19ClFN5O — CID 86970051
1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]urea (PubChem CID 86970051) has the molecular formula C21H19ClFN5O and a molecular weight of 411.87 g/mol. Its IUPAC name is 1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]urea.
| Compound Name | 1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 86970051 |
| Molecular Formula | C21H19ClFN5O |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]urea |
| SMILES | O=C(NCCc1c[nH]c2cc(F)ccc12)NCc1cnn(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H19ClFN5O/c22-16-1-4-18(5-2-16)28-13-14(11-27-28)10-26-21(29)24-8-7-15-12-25-20-9-17(23)3-6-19(15)20/h1-6,9,11-13,25H,7-8,10H2,(H2,24,26,29) |
| InChIKey | WWAYABXTWBGFOF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |