C18H26ClNO2S — CID 86971614
N-[(2-tert-butyloxan-3-yl)methyl]-2-chloro-5-methylsulfanylbenzamide (PubChem CID 86971614) has the molecular formula C18H26ClNO2S and a molecular weight of 355.93 g/mol. Its IUPAC name is N-[(2-tert-butyloxan-3-yl)methyl]-2-chloro-5-methylsulfanylbenzamide.
| Compound Name | N-[(2-tert-butyloxan-3-yl)methyl]-2-chloro-5-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 86971614 |
| Molecular Formula | C18H26ClNO2S |
| Molecular Weight | 355.93 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-[(2-tert-butyloxan-3-yl)methyl]-2-chloro-5-methylsulfanylbenzamide |
| SMILES | CSc1ccc(Cl)c(C(=O)NCC2CCCOC2C(C)(C)C)c1 |
| InChI | InChI=1S/C18H26ClNO2S/c1-18(2,3)16-12(6-5-9-22-16)11-20-17(21)14-10-13(23-4)7-8-15(14)19/h7-8,10,12,16H,5-6,9,11H2,1-4H3,(H,20,21) |
| InChIKey | FBADMQWUQAVSPH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.93 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |