C20H29NO2S — CID 86971629
(E)-N-[(2-tert-butyloxan-3-yl)methyl]-3-(4-methylsulfanylphenyl)prop-2-enamide (PubChem CID 86971629) has the molecular formula C20H29NO2S and a molecular weight of 347.52 g/mol. Its IUPAC name is (E)-N-[(2-tert-butyloxan-3-yl)methyl]-3-(4-methylsulfanylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(2-tert-butyloxan-3-yl)methyl]-3-(4-methylsulfanylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 86971629 |
| Molecular Formula | C20H29NO2S |
| Molecular Weight | 347.52 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | (E)-N-[(2-tert-butyloxan-3-yl)methyl]-3-(4-methylsulfanylphenyl)prop-2-enamide |
| SMILES | CSc1ccc(/C=C/C(=O)NCC2CCCOC2C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H29NO2S/c1-20(2,3)19-16(6-5-13-23-19)14-21-18(22)12-9-15-7-10-17(24-4)11-8-15/h7-12,16,19H,5-6,13-14H2,1-4H3,(H,21,22)/b12-9+ |
| InChIKey | ZGFYDTHLVQLRFT-FMIVXFBMSA-N |
| XLogP | 4.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|