C19H22ClN5O4 — CID 86974651
1-[5-chloro-2-(2-ethoxyethoxy)phenyl]-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]urea (PubChem CID 86974651) has the molecular formula C19H22ClN5O4 and a molecular weight of 419.87 g/mol. Its IUPAC name is 1-[5-chloro-2-(2-ethoxyethoxy)phenyl]-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]urea.
| Compound Name | 1-[5-chloro-2-(2-ethoxyethoxy)phenyl]-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]urea |
|---|---|
| PubChem CID | 86974651 |
| Molecular Formula | C19H22ClN5O4 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 1-[5-chloro-2-(2-ethoxyethoxy)phenyl]-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]urea |
| SMILES | CCOCCOc1ccc(Cl)cc1NC(=O)NCCc1nc(-c2ccco2)n[nH]1 |
| InChI | InChI=1S/C19H22ClN5O4/c1-2-27-10-11-29-15-6-5-13(20)12-14(15)22-19(26)21-8-7-17-23-18(25-24-17)16-4-3-9-28-16/h3-6,9,12H,2,7-8,10-11H2,1H3,(H2,21,22,26)(H,23,24,25) |
| InChIKey | TZFKMHJOKHXFKX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|