C20H26ClN3O4 — CID 86887689
N-[5-chloro-2-(2-ethoxyethoxy)phenyl]-4-(furan-2-ylmethyl)piperazine-1-carboxamide (PubChem CID 86887689) has the molecular formula C20H26ClN3O4 and a molecular weight of 407.90 g/mol. Its IUPAC name is N-[5-chloro-2-(2-ethoxyethoxy)phenyl]-4-(furan-2-ylmethyl)piperazine-1-carboxamide.
| Compound Name | N-[5-chloro-2-(2-ethoxyethoxy)phenyl]-4-(furan-2-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 86887689 |
| Molecular Formula | C20H26ClN3O4 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-[5-chloro-2-(2-ethoxyethoxy)phenyl]-4-(furan-2-ylmethyl)piperazine-1-carboxamide |
| SMILES | CCOCCOc1ccc(Cl)cc1NC(=O)N1CCN(Cc2ccco2)CC1 |
| InChI | InChI=1S/C20H26ClN3O4/c1-2-26-12-13-28-19-6-5-16(21)14-18(19)22-20(25)24-9-7-23(8-10-24)15-17-4-3-11-27-17/h3-6,11,14H,2,7-10,12-13,15H2,1H3,(H,22,25) |
| InChIKey | XADBWEXACDCNFY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 67.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|