C14H19ClN2O3S — CID 86976250
2-[[4-(5-chlorothiophen-2-yl)-4-oxobutanoyl]amino]-3-methylpentanamide (PubChem CID 86976250) has the molecular formula C14H19ClN2O3S and a molecular weight of 330.84 g/mol. Its IUPAC name is 2-[[4-(5-chlorothiophen-2-yl)-4-oxobutanoyl]amino]-3-methylpentanamide.
| Compound Name | 2-[[4-(5-chlorothiophen-2-yl)-4-oxobutanoyl]amino]-3-methylpentanamide |
|---|---|
| PubChem CID | 86976250 |
| Molecular Formula | C14H19ClN2O3S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-[[4-(5-chlorothiophen-2-yl)-4-oxobutanoyl]amino]-3-methylpentanamide |
| SMILES | CCC(C)C(NC(=O)CCC(=O)c1ccc(Cl)s1)C(N)=O |
| InChI | InChI=1S/C14H19ClN2O3S/c1-3-8(2)13(14(16)20)17-12(19)7-4-9(18)10-5-6-11(15)21-10/h5-6,8,13H,3-4,7H2,1-2H3,(H2,16,20)(H,17,19) |
| InChIKey | ZTQUTMWJMCUBEW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |