C16H16F2N2O4 — CID 86996640
N'-(2,4-difluorophenyl)-N-[3-(furan-2-ylmethoxy)propyl]oxamide (PubChem CID 86996640) has the molecular formula C16H16F2N2O4 and a molecular weight of 338.31 g/mol. Its IUPAC name is N'-(2,4-difluorophenyl)-N-[3-(furan-2-ylmethoxy)propyl]oxamide.
| Compound Name | N'-(2,4-difluorophenyl)-N-[3-(furan-2-ylmethoxy)propyl]oxamide |
|---|---|
| PubChem CID | 86996640 |
| Molecular Formula | C16H16F2N2O4 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | N'-(2,4-difluorophenyl)-N-[3-(furan-2-ylmethoxy)propyl]oxamide |
| SMILES | O=C(NCCCOCc1ccco1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C16H16F2N2O4/c17-11-4-5-14(13(18)9-11)20-16(22)15(21)19-6-2-7-23-10-12-3-1-8-24-12/h1,3-5,8-9H,2,6-7,10H2,(H,19,21)(H,20,22) |
| InChIKey | JWEOHDYLUZGEIS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|