C18H22F2N2O3 — CID 87038251
1-[1-(2,5-difluorophenyl)ethyl]-3-[3-(furan-2-ylmethoxy)propyl]-1-methylurea (PubChem CID 87038251) has the molecular formula C18H22F2N2O3 and a molecular weight of 352.38 g/mol. Its IUPAC name is 1-[1-(2,5-difluorophenyl)ethyl]-3-[3-(furan-2-ylmethoxy)propyl]-1-methylurea.
| Compound Name | 1-[1-(2,5-difluorophenyl)ethyl]-3-[3-(furan-2-ylmethoxy)propyl]-1-methylurea |
|---|---|
| PubChem CID | 87038251 |
| Molecular Formula | C18H22F2N2O3 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-[1-(2,5-difluorophenyl)ethyl]-3-[3-(furan-2-ylmethoxy)propyl]-1-methylurea |
| SMILES | CC(c1cc(F)ccc1F)N(C)C(=O)NCCCOCc1ccco1 |
| InChI | InChI=1S/C18H22F2N2O3/c1-13(16-11-14(19)6-7-17(16)20)22(2)18(23)21-8-4-9-24-12-15-5-3-10-25-15/h3,5-7,10-11,13H,4,8-9,12H2,1-2H3,(H,21,23) |
| InChIKey | SKIFSISUSHEUSB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|