C19H19N5O — CID 869972
3-phenyl-N-(4,5,6,7-tetrahydro-1H-indol-2-ylmethylideneamino)-1H-pyrazole-5-carboxamide (PubChem CID 869972) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is 3-phenyl-N-(4,5,6,7-tetrahydro-1H-indol-2-ylmethylideneamino)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-phenyl-N-(4,5,6,7-tetrahydro-1H-indol-2-ylmethylideneamino)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 869972 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 3-phenyl-N-(4,5,6,7-tetrahydro-1H-indol-2-ylmethylideneamino)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NN=Cc1cc2c([nH]1)CCCC2)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C19H19N5O/c25-19(18-11-17(22-23-18)13-6-2-1-3-7-13)24-20-12-15-10-14-8-4-5-9-16(14)21-15/h1-3,6-7,10-12,21H,4-5,8-9H2,(H,22,23)(H,24,25) |
| InChIKey | QSTHJBMUTSZGQX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|