C15H21N5OS — CID 87009129
1-[(6-methyl-2-pyridinyl)methyl]-3-(5-pentyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 87009129) has the molecular formula C15H21N5OS and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-[(6-methyl-2-pyridinyl)methyl]-3-(5-pentyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[(6-methyl-2-pyridinyl)methyl]-3-(5-pentyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 87009129 |
| Molecular Formula | C15H21N5OS |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-[(6-methyl-2-pyridinyl)methyl]-3-(5-pentyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCCCCc1nnc(NC(=O)NCc2cccc(C)n2)s1 |
| InChI | InChI=1S/C15H21N5OS/c1-3-4-5-9-13-19-20-15(22-13)18-14(21)16-10-12-8-6-7-11(2)17-12/h6-8H,3-5,9-10H2,1-2H3,(H2,16,18,20,21) |
| InChIKey | STZOSRKMNRPVJB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|