C16H13ClN2OS2 — CID 8702266
N-(4-chloro-1,3-benzothiazol-7-yl)-3-ethylsulfanylbenzamide (PubChem CID 8702266) has the molecular formula C16H13ClN2OS2 and a molecular weight of 348.88 g/mol. Its IUPAC name is N-(4-chloro-1,3-benzothiazol-7-yl)-3-ethylsulfanylbenzamide.
| Compound Name | N-(4-chloro-1,3-benzothiazol-7-yl)-3-ethylsulfanylbenzamide |
|---|---|
| PubChem CID | 8702266 |
| Molecular Formula | C16H13ClN2OS2 |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | N-(4-chloro-1,3-benzothiazol-7-yl)-3-ethylsulfanylbenzamide |
| SMILES | CCSc1cccc(C(=O)Nc2ccc(Cl)c3ncsc23)c1 |
| InChI | InChI=1S/C16H13ClN2OS2/c1-2-21-11-5-3-4-10(8-11)16(20)19-13-7-6-12(17)14-15(13)22-9-18-14/h3-9H,2H2,1H3,(H,19,20) |
| InChIKey | AIAPALPPKFRGFE-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |