C16H11ClN2O3S — CID 8702098
methyl 4-[(4-chloro-1,3-benzothiazol-7-yl)carbamoyl]benzoate (PubChem CID 8702098) has the molecular formula C16H11ClN2O3S and a molecular weight of 346.80 g/mol. Its IUPAC name is methyl 4-[(4-chloro-1,3-benzothiazol-7-yl)carbamoyl]benzoate.
| Compound Name | methyl 4-[(4-chloro-1,3-benzothiazol-7-yl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 8702098 |
| Molecular Formula | C16H11ClN2O3S |
| Molecular Weight | 346.80 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | methyl 4-[(4-chloro-1,3-benzothiazol-7-yl)carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2ccc(Cl)c3ncsc23)cc1 |
| InChI | InChI=1S/C16H11ClN2O3S/c1-22-16(21)10-4-2-9(3-5-10)15(20)19-12-7-6-11(17)13-14(12)23-8-18-13/h2-8H,1H3,(H,19,20) |
| InChIKey | ZLKCJJMQFYVMCE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.80 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |