C13H21N3O3S2 — CID 87032485
1-methyl-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)pyrazole-4-sulfonamide (PubChem CID 87032485) has the molecular formula C13H21N3O3S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-methyl-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)pyrazole-4-sulfonamide.
| Compound Name | 1-methyl-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 87032485 |
| Molecular Formula | C13H21N3O3S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 1-methyl-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)pyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)N(CC2CCCO2)C2CCSC2)cn1 |
| InChI | InChI=1S/C13H21N3O3S2/c1-15-9-13(7-14-15)21(17,18)16(11-4-6-20-10-11)8-12-3-2-5-19-12/h7,9,11-12H,2-6,8,10H2,1H3 |
| InChIKey | DJIZUYCEMGLXBA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |