C17H13BrN4O — CID 87035093
1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-(3-ethynylphenyl)urea (PubChem CID 87035093) has the molecular formula C17H13BrN4O and a molecular weight of 369.22 g/mol. Its IUPAC name is 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-(3-ethynylphenyl)urea.
| Compound Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-(3-ethynylphenyl)urea |
|---|---|
| PubChem CID | 87035093 |
| Molecular Formula | C17H13BrN4O |
| Molecular Weight | 369.22 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-(3-ethynylphenyl)urea |
| SMILES | C#Cc1cccc(NC(=O)NCc2cn3cc(Br)ccc3n2)c1 |
| InChI | InChI=1S/C17H13BrN4O/c1-2-12-4-3-5-14(8-12)21-17(23)19-9-15-11-22-10-13(18)6-7-16(22)20-15/h1,3-8,10-11H,9H2,(H2,19,21,23) |
| InChIKey | MIJNNXAUXIVQDF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.22 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|