C19H20N4O3S — CID 87038386
1-[2-(benzenesulfonyl)ethyl]-3-[(1-phenylpyrazol-4-yl)methyl]urea (PubChem CID 87038386) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)ethyl]-3-[(1-phenylpyrazol-4-yl)methyl]urea.
| Compound Name | 1-[2-(benzenesulfonyl)ethyl]-3-[(1-phenylpyrazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 87038386 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-[2-(benzenesulfonyl)ethyl]-3-[(1-phenylpyrazol-4-yl)methyl]urea |
| SMILES | O=C(NCCS(=O)(=O)c1ccccc1)NCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H20N4O3S/c24-19(20-11-12-27(25,26)18-9-5-2-6-10-18)21-13-16-14-22-23(15-16)17-7-3-1-4-8-17/h1-10,14-15H,11-13H2,(H2,20,21,24) |
| InChIKey | PSZGNFFOVGZFHD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |