C32H36ClN3O4 — CID 87048756
(5R,7S)-6-N-(3-chlorophenyl)-2-N-(2,3-dimethylcyclohexyl)-4-oxo-3-(1-phenylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 87048756) has the molecular formula C32H36ClN3O4 and a molecular weight of 562.11 g/mol. Its IUPAC name is (5R,7S)-6-N-(3-chlorophenyl)-2-N-(2,3-dimethylcyclohexyl)-4-oxo-3-(1-phenylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (5R,7S)-6-N-(3-chlorophenyl)-2-N-(2,3-dimethylcyclohexyl)-4-oxo-3-(1-phenylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87048756 |
| Molecular Formula | C32H36ClN3O4 |
| Molecular Weight | 562.11 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | (5R,7S)-6-N-(3-chlorophenyl)-2-N-(2,3-dimethylcyclohexyl)-4-oxo-3-(1-phenylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CC1CCCC(NC(=O)C2N(C(C)c3ccccc3)C(=O)[C@@H]3C(C(=O)Nc4cccc(Cl)c4)[C@@H]4C=CC23O4)C1C |
| InChI | InChI=1S/C32H36ClN3O4/c1-18-9-7-14-24(19(18)2)35-30(38)28-32-16-15-25(40-32)26(29(37)34-23-13-8-12-22(33)17-23)27(32)31(39)36(28)20(3)21-10-5-4-6-11-21/h4-6,8,10-13,15-20,24-28H,7,9,14H2,1-3H3,(H,34,37)(H,35,38)/t18?,19?,20?,24?,25-,26?,27-,28?,32?/m0/s1 |
| InChIKey | SLRNAIGLPNUOFI-XTEKXURCSA-N |
| XLogP | 5.13 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.11 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|