C30H41N3O4 — CID 87048884
(5S,7R)-3-butan-2-yl-2-N-(2,3-dimethylcyclohexyl)-6-N-(3,4-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 87048884) has the molecular formula C30H41N3O4 and a molecular weight of 507.68 g/mol. Its IUPAC name is (5S,7R)-3-butan-2-yl-2-N-(2,3-dimethylcyclohexyl)-6-N-(3,4-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (5S,7R)-3-butan-2-yl-2-N-(2,3-dimethylcyclohexyl)-6-N-(3,4-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87048884 |
| Molecular Formula | C30H41N3O4 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | (5S,7R)-3-butan-2-yl-2-N-(2,3-dimethylcyclohexyl)-6-N-(3,4-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCC(C)N1C(=O)[C@H]2C(C(=O)Nc3ccc(C)c(C)c3)[C@H]3C=CC2(O3)C1C(=O)NC1CCCC(C)C1C |
| InChI | InChI=1S/C30H41N3O4/c1-7-19(5)33-26(28(35)32-22-10-8-9-17(3)20(22)6)30-14-13-23(37-30)24(25(30)29(33)36)27(34)31-21-12-11-16(2)18(4)15-21/h11-15,17,19-20,22-26H,7-10H2,1-6H3,(H,31,34)(H,32,35)/t17?,19?,20?,22?,23-,24?,25-,26?,30?/m1/s1 |
| InChIKey | VNVLKUHBSRMMSM-ACKOSKJNSA-N |
| XLogP | 4.13 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|