C22H45NO4P+ — CID 87061759
[(7Z,16Z)-2-hydroxy-2-phosphonononadeca-7,16-dienyl]-trimethylazanium (PubChem CID 87061759) has the molecular formula C22H45NO4P+ and a molecular weight of 418.58 g/mol. Its IUPAC name is [(7Z,16Z)-2-hydroxy-2-phosphonononadeca-7,16-dienyl]-trimethylazanium.
| Compound Name | [(7Z,16Z)-2-hydroxy-2-phosphonononadeca-7,16-dienyl]-trimethylazanium |
|---|---|
| PubChem CID | 87061759 |
| Molecular Formula | C22H45NO4P+ |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | [(7Z,16Z)-2-hydroxy-2-phosphonononadeca-7,16-dienyl]-trimethylazanium |
| SMILES | CC/C=C\CCCCCCC/C=C\CCCCC(O)(C[N+](C)(C)C)P(=O)(O)O |
| InChI | InChI=1S/C22H44NO4P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(24,28(25,26)27)21-23(2,3)4/h6-7,15-16,24H,5,8-14,17-21H2,1-4H3,(H-,25,26,27)/p+1/b7-6-,16-15- |
| InChIKey | HSDKECBDUVBPPK-OYAITDOQSA-O |
| XLogP | 5.37 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|